C19H22Cl2N2O2 — CID 119576539
[3-[(3-chlorophenyl)methoxy]phenyl]-(3-methylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 119576539) has the molecular formula C19H22Cl2N2O2 and a molecular weight of 381.30 g/mol. Its IUPAC name is [3-[(3-chlorophenyl)methoxy]phenyl]-(3-methylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | [3-[(3-chlorophenyl)methoxy]phenyl]-(3-methylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119576539 |
| Molecular Formula | C19H22Cl2N2O2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [3-[(3-chlorophenyl)methoxy]phenyl]-(3-methylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | CC1CN(C(=O)c2cccc(OCc3cccc(Cl)c3)c2)CCN1.Cl |
| InChI | InChI=1S/C19H21ClN2O2.ClH/c1-14-12-22(9-8-21-14)19(23)16-5-3-7-18(11-16)24-13-15-4-2-6-17(20)10-15;/h2-7,10-11,14,21H,8-9,12-13H2,1H3;1H |
| InChIKey | QABIHPJNGBRBPU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |