C18H27ClN2O3 — CID 119578140
(4-butoxy-3-chloro-5-ethoxyphenyl)-(3-methylpiperazin-1-yl)methanone (PubChem CID 119578140) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is (4-butoxy-3-chloro-5-ethoxyphenyl)-(3-methylpiperazin-1-yl)methanone.
| Compound Name | (4-butoxy-3-chloro-5-ethoxyphenyl)-(3-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 119578140 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (4-butoxy-3-chloro-5-ethoxyphenyl)-(3-methylpiperazin-1-yl)methanone |
| SMILES | CCCCOc1c(Cl)cc(C(=O)N2CCNC(C)C2)cc1OCC |
| InChI | InChI=1S/C18H27ClN2O3/c1-4-6-9-24-17-15(19)10-14(11-16(17)23-5-2)18(22)21-8-7-20-13(3)12-21/h10-11,13,20H,4-9,12H2,1-3H3 |
| InChIKey | ADTJYTOJEYCHBK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|