About N-(1-aminopropan-2-yl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;hydrochloride
N-(1-aminopropan-2-yl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;hydrochloride (PubChem CID 119581850) has the molecular formula C14H19ClN4O2
and a molecular weight of 310.79 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-(1-aminopropan-2-yl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;hydrochloride |
| PubChem CID | 119581850 |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N-(1-aminopropan-2-yl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;hydrochloride |
| SMILES | Cc1ccn2c(=O)c(C(=O)N(C)C(C)CN)cnc2c1.Cl |
| InChI | InChI=1S/C14H18N4O2.ClH/c1-9-4-5-18-12(6-9)16-8-11(14(18)20)13(19)17(3)10(2)7-15;/h4-6,8,10H,7,15H2,1-3H3;1H |
| InChIKey | VEMPQPKRFQVDGV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-aminopropan-2-yl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-aminopropan-2-yl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;hydrochloride?
The IUPAC name of N-(1-aminopropan-2-yl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;hydrochloride (CID 119581850) is N-(1-aminopropan-2-yl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;hydrochloride.
What is the SMILES notation for N-(1-aminopropan-2-yl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;hydrochloride?
The canonical SMILES for N-(1-aminopropan-2-yl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;hydrochloride is Cc1ccn2c(=O)c(C(=O)N(C)C(C)CN)cnc2c1.Cl.
What is the InChIKey of N-(1-aminopropan-2-yl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;hydrochloride?
The InChIKey is VEMPQPKRFQVDGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2.ClH/c1-9-4-5-18-12(6-9)16-8-11(14(18)20)13(19)17(3)10(2)7-15;/h4-6,8,10H,7,15H2,1-3H3;1H.
What are the key properties of N-(1-aminopropan-2-yl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;hydrochloride?
N-(1-aminopropan-2-yl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;hydrochloride has a molecular weight of 310.79 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-aminopropan-2-yl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;hydrochloride is sourced from PubChem (CID 119581850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).