C19H23N3O2S — CID 11958423
3-ethoxy-2-propyl-N-(2-thiophen-2-ylethyl)indazole-6-carboxamide (PubChem CID 11958423) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 3-ethoxy-2-propyl-N-(2-thiophen-2-ylethyl)indazole-6-carboxamide.
| Compound Name | 3-ethoxy-2-propyl-N-(2-thiophen-2-ylethyl)indazole-6-carboxamide |
|---|---|
| PubChem CID | 11958423 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-ethoxy-2-propyl-N-(2-thiophen-2-ylethyl)indazole-6-carboxamide |
| SMILES | CCCn1nc2cc(C(=O)NCCc3cccs3)ccc2c1OCC |
| InChI | InChI=1S/C19H23N3O2S/c1-3-11-22-19(24-4-2)16-8-7-14(13-17(16)21-22)18(23)20-10-9-15-6-5-12-25-15/h5-8,12-13H,3-4,9-11H2,1-2H3,(H,20,23) |
| InChIKey | GSKMGAGLJIMSNR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |