About 2-butyl-N-(2,3-dihydro-1H-inden-1-yl)-3-ethoxyindazole-6-carboxamide
2-butyl-N-(2,3-dihydro-1H-inden-1-yl)-3-ethoxyindazole-6-carboxamide (PubChem CID 11958409) has the molecular formula C23H27N3O2
and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-butyl-N-(2,3-dihydro-1H-inden-1-yl)-3-ethoxyindazole-6-carboxamide.
Molecular Properties
| Compound Name | 2-butyl-N-(2,3-dihydro-1H-inden-1-yl)-3-ethoxyindazole-6-carboxamide |
| PubChem CID | 11958409 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-butyl-N-(2,3-dihydro-1H-inden-1-yl)-3-ethoxyindazole-6-carboxamide |
| SMILES | CCCCn1nc2cc(C(=O)NC3CCc4ccccc43)ccc2c1OCC |
| InChI | InChI=1S/C23H27N3O2/c1-3-5-14-26-23(28-4-2)19-12-10-17(15-21(19)25-26)22(27)24-20-13-11-16-8-6-7-9-18(16)20/h6-10,12,15,20H,3-5,11,13-14H2,1-2H3,(H,24,27) |
| InChIKey | ITZISJJTUNFAFL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-butyl-N-(2,3-dihydro-1H-inden-1-yl)-3-ethoxyindazole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-N-(2,3-dihydro-1H-inden-1-yl)-3-ethoxyindazole-6-carboxamide?
The IUPAC name of 2-butyl-N-(2,3-dihydro-1H-inden-1-yl)-3-ethoxyindazole-6-carboxamide (CID 11958409) is 2-butyl-N-(2,3-dihydro-1H-inden-1-yl)-3-ethoxyindazole-6-carboxamide.
What is the SMILES notation for 2-butyl-N-(2,3-dihydro-1H-inden-1-yl)-3-ethoxyindazole-6-carboxamide?
The canonical SMILES for 2-butyl-N-(2,3-dihydro-1H-inden-1-yl)-3-ethoxyindazole-6-carboxamide is CCCCn1nc2cc(C(=O)NC3CCc4ccccc43)ccc2c1OCC.
What is the InChIKey of 2-butyl-N-(2,3-dihydro-1H-inden-1-yl)-3-ethoxyindazole-6-carboxamide?
The InChIKey is ITZISJJTUNFAFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O2/c1-3-5-14-26-23(28-4-2)19-12-10-17(15-21(19)25-26)22(27)24-20-13-11-16-8-6-7-9-18(16)20/h6-10,12,15,20H,3-5,11,13-14H2,1-2H3,(H,24,27).
What are the key properties of 2-butyl-N-(2,3-dihydro-1H-inden-1-yl)-3-ethoxyindazole-6-carboxamide?
2-butyl-N-(2,3-dihydro-1H-inden-1-yl)-3-ethoxyindazole-6-carboxamide has a molecular weight of 377.49 g/mol, XLogP of 4.65, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-N-(2,3-dihydro-1H-inden-1-yl)-3-ethoxyindazole-6-carboxamide is sourced from PubChem (CID 11958409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).