C21H22F3N3O3 — CID 11958432
3-ethoxy-2-propyl-N-[[4-(trifluoromethoxy)phenyl]methyl]indazole-6-carboxamide (PubChem CID 11958432) has the molecular formula C21H22F3N3O3 and a molecular weight of 421.42 g/mol. Its IUPAC name is 3-ethoxy-2-propyl-N-[[4-(trifluoromethoxy)phenyl]methyl]indazole-6-carboxamide.
| Compound Name | 3-ethoxy-2-propyl-N-[[4-(trifluoromethoxy)phenyl]methyl]indazole-6-carboxamide |
|---|---|
| PubChem CID | 11958432 |
| Molecular Formula | C21H22F3N3O3 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3-ethoxy-2-propyl-N-[[4-(trifluoromethoxy)phenyl]methyl]indazole-6-carboxamide |
| SMILES | CCCn1nc2cc(C(=O)NCc3ccc(OC(F)(F)F)cc3)ccc2c1OCC |
| InChI | InChI=1S/C21H22F3N3O3/c1-3-11-27-20(29-4-2)17-10-7-15(12-18(17)26-27)19(28)25-13-14-5-8-16(9-6-14)30-21(22,23)24/h5-10,12H,3-4,11,13H2,1-2H3,(H,25,28) |
| InChIKey | KGVHEGWVNMILOY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |