C20H20F3N3O3 — CID 11958435
3-ethoxy-2-ethyl-N-[[4-(trifluoromethoxy)phenyl]methyl]indazole-6-carboxamide (PubChem CID 11958435) has the molecular formula C20H20F3N3O3 and a molecular weight of 407.39 g/mol. Its IUPAC name is 3-ethoxy-2-ethyl-N-[[4-(trifluoromethoxy)phenyl]methyl]indazole-6-carboxamide.
| Compound Name | 3-ethoxy-2-ethyl-N-[[4-(trifluoromethoxy)phenyl]methyl]indazole-6-carboxamide |
|---|---|
| PubChem CID | 11958435 |
| Molecular Formula | C20H20F3N3O3 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 3-ethoxy-2-ethyl-N-[[4-(trifluoromethoxy)phenyl]methyl]indazole-6-carboxamide |
| SMILES | CCOc1c2ccc(C(=O)NCc3ccc(OC(F)(F)F)cc3)cc2nn1CC |
| InChI | InChI=1S/C20H20F3N3O3/c1-3-26-19(28-4-2)16-10-7-14(11-17(16)25-26)18(27)24-12-13-5-8-15(9-6-13)29-20(21,22)23/h5-11H,3-4,12H2,1-2H3,(H,24,27) |
| InChIKey | MQTYECCKJMFZKP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |