C15H13FN2O4S — CID 11958601
3-[(4-fluorophenyl)sulfanylmethyl]-5-(prop-2-enylcarbamoyl)-1,2-oxazole-4-carboxylic acid (PubChem CID 11958601) has the molecular formula C15H13FN2O4S and a molecular weight of 336.34 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)sulfanylmethyl]-5-(prop-2-enylcarbamoyl)-1,2-oxazole-4-carboxylic acid.
| Compound Name | 3-[(4-fluorophenyl)sulfanylmethyl]-5-(prop-2-enylcarbamoyl)-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 11958601 |
| Molecular Formula | C15H13FN2O4S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 3-[(4-fluorophenyl)sulfanylmethyl]-5-(prop-2-enylcarbamoyl)-1,2-oxazole-4-carboxylic acid |
| SMILES | C=CCNC(=O)c1onc(CSc2ccc(F)cc2)c1C(=O)O |
| InChI | InChI=1S/C15H13FN2O4S/c1-2-7-17-14(19)13-12(15(20)21)11(18-22-13)8-23-10-5-3-9(16)4-6-10/h2-6H,1,7-8H2,(H,17,19)(H,20,21) |
| InChIKey | GMLHELGUTASQCP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|