About 3-[(2-fluorophenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid
3-[(2-fluorophenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid (PubChem CID 11958566) has the molecular formula C15H15FN2O5S
and a molecular weight of 354.36 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(2-fluorophenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid |
| PubChem CID | 11958566 |
| Molecular Formula | C15H15FN2O5S |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 3-[(2-fluorophenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid |
| SMILES | COCCNC(=O)c1onc(CSc2ccccc2F)c1C(=O)O |
| InChI | InChI=1S/C15H15FN2O5S/c1-22-7-6-17-14(19)13-12(15(20)21)10(18-23-13)8-24-11-5-3-2-4-9(11)16/h2-5H,6-8H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | DOASQTKPGMCSCW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-fluorophenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-fluorophenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid?
The IUPAC name of 3-[(2-fluorophenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid (CID 11958566) is 3-[(2-fluorophenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid.
What is the SMILES notation for 3-[(2-fluorophenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid?
The canonical SMILES for 3-[(2-fluorophenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid is COCCNC(=O)c1onc(CSc2ccccc2F)c1C(=O)O.
What is the InChIKey of 3-[(2-fluorophenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid?
The InChIKey is DOASQTKPGMCSCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FN2O5S/c1-22-7-6-17-14(19)13-12(15(20)21)10(18-23-13)8-24-11-5-3-2-4-9(11)16/h2-5H,6-8H2,1H3,(H,17,19)(H,20,21).
What are the key properties of 3-[(2-fluorophenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid?
3-[(2-fluorophenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid has a molecular weight of 354.36 g/mol, XLogP of 2.18, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-fluorophenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid is sourced from PubChem (CID 11958566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).