C16H18N2O6S — CID 11958464
5-(2-methoxyethylcarbamoyl)-3-[(3-methoxyphenyl)sulfanylmethyl]-1,2-oxazole-4-carboxylic acid (PubChem CID 11958464) has the molecular formula C16H18N2O6S and a molecular weight of 366.40 g/mol. Its IUPAC name is 5-(2-methoxyethylcarbamoyl)-3-[(3-methoxyphenyl)sulfanylmethyl]-1,2-oxazole-4-carboxylic acid.
| Compound Name | 5-(2-methoxyethylcarbamoyl)-3-[(3-methoxyphenyl)sulfanylmethyl]-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 11958464 |
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 5-(2-methoxyethylcarbamoyl)-3-[(3-methoxyphenyl)sulfanylmethyl]-1,2-oxazole-4-carboxylic acid |
| SMILES | COCCNC(=O)c1onc(CSc2cccc(OC)c2)c1C(=O)O |
| InChI | InChI=1S/C16H18N2O6S/c1-22-7-6-17-15(19)14-13(16(20)21)12(18-24-14)9-25-11-5-3-4-10(8-11)23-2/h3-5,8H,6-7,9H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | VSWUGSXLOJRKHI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|