C19H26N4O3S — CID 24747888
4-N,5-N-dibutyl-3-(pyridin-2-ylsulfanylmethyl)-1,2-oxazole-4,5-dicarboxamide (PubChem CID 24747888) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 4-N,5-N-dibutyl-3-(pyridin-2-ylsulfanylmethyl)-1,2-oxazole-4,5-dicarboxamide.
| Compound Name | 4-N,5-N-dibutyl-3-(pyridin-2-ylsulfanylmethyl)-1,2-oxazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 24747888 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-N,5-N-dibutyl-3-(pyridin-2-ylsulfanylmethyl)-1,2-oxazole-4,5-dicarboxamide |
| SMILES | CCCCNC(=O)c1onc(CSc2ccccn2)c1C(=O)NCCCC |
| InChI | InChI=1S/C19H26N4O3S/c1-3-5-10-21-18(24)16-14(13-27-15-9-7-8-12-20-15)23-26-17(16)19(25)22-11-6-4-2/h7-9,12H,3-6,10-11,13H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | XQDFJWNEKMFEGK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|