C17H24ClN3O3S — CID 119587264
N-(1-amino-4-methylpentan-2-yl)-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide;hydrochloride (PubChem CID 119587264) has the molecular formula C17H24ClN3O3S and a molecular weight of 385.92 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119587264 |
| Molecular Formula | C17H24ClN3O3S |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide;hydrochloride |
| SMILES | CC(C)CC(CN)NC(=O)c1cccc(CN2C(=O)CSC2=O)c1.Cl |
| InChI | InChI=1S/C17H23N3O3S.ClH/c1-11(2)6-14(8-18)19-16(22)13-5-3-4-12(7-13)9-20-15(21)10-24-17(20)23;/h3-5,7,11,14H,6,8-10,18H2,1-2H3,(H,19,22);1H |
| InChIKey | MATLEUMFQNPTLM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|