C16H21N3O3S — CID 120654281
3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[(2R)-2-(ethylamino)propyl]benzamide (PubChem CID 120654281) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[(2R)-2-(ethylamino)propyl]benzamide.
| Compound Name | 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[(2R)-2-(ethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 120654281 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[(2R)-2-(ethylamino)propyl]benzamide |
| SMILES | CCN[C@H](C)CNC(=O)c1cccc(CN2C(=O)CSC2=O)c1 |
| InChI | InChI=1S/C16H21N3O3S/c1-3-17-11(2)8-18-15(21)13-6-4-5-12(7-13)9-19-14(20)10-23-16(19)22/h4-7,11,17H,3,8-10H2,1-2H3,(H,18,21)/t11-/m1/s1 |
| InChIKey | RKZGJVSTVUATRS-LLVKDONJSA-N |
| XLogP | 1.61 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|