C17H27Cl2N3O2 — CID 119587703
3-acetamido-N-(1-amino-4-methylpentan-2-yl)-3-(4-chlorophenyl)propanamide;hydrochloride (PubChem CID 119587703) has the molecular formula C17H27Cl2N3O2 and a molecular weight of 376.33 g/mol. Its IUPAC name is 3-acetamido-N-(1-amino-4-methylpentan-2-yl)-3-(4-chlorophenyl)propanamide;hydrochloride.
| Compound Name | 3-acetamido-N-(1-amino-4-methylpentan-2-yl)-3-(4-chlorophenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119587703 |
| Molecular Formula | C17H27Cl2N3O2 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 3-acetamido-N-(1-amino-4-methylpentan-2-yl)-3-(4-chlorophenyl)propanamide;hydrochloride |
| SMILES | CC(=O)NC(CC(=O)NC(CN)CC(C)C)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C17H26ClN3O2.ClH/c1-11(2)8-15(10-19)21-17(23)9-16(20-12(3)22)13-4-6-14(18)7-5-13;/h4-7,11,15-16H,8-10,19H2,1-3H3,(H,20,22)(H,21,23);1H |
| InChIKey | NAYPSDFKMKBSJH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |