C16H20BrFN4O — CID 119587937
N-(1-amino-4-methylpentan-2-yl)-4-bromo-1-(4-fluorophenyl)pyrazole-3-carboxamide (PubChem CID 119587937) has the molecular formula C16H20BrFN4O and a molecular weight of 383.27 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-4-bromo-1-(4-fluorophenyl)pyrazole-3-carboxamide.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-4-bromo-1-(4-fluorophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 119587937 |
| Molecular Formula | C16H20BrFN4O |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-4-bromo-1-(4-fluorophenyl)pyrazole-3-carboxamide |
| SMILES | CC(C)CC(CN)NC(=O)c1nn(-c2ccc(F)cc2)cc1Br |
| InChI | InChI=1S/C16H20BrFN4O/c1-10(2)7-12(8-19)20-16(23)15-14(17)9-22(21-15)13-5-3-11(18)4-6-13/h3-6,9-10,12H,7-8,19H2,1-2H3,(H,20,23) |
| InChIKey | XROPJQAQLASYKR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |