C15H22ClN5O — CID 119588205
N-(1-amino-4-methylpentan-2-yl)-2-phenyltriazole-4-carboxamide;hydrochloride (PubChem CID 119588205) has the molecular formula C15H22ClN5O and a molecular weight of 323.83 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-2-phenyltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-2-phenyltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119588205 |
| Molecular Formula | C15H22ClN5O |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-2-phenyltriazole-4-carboxamide;hydrochloride |
| SMILES | CC(C)CC(CN)NC(=O)c1cnn(-c2ccccc2)n1.Cl |
| InChI | InChI=1S/C15H21N5O.ClH/c1-11(2)8-12(9-16)18-15(21)14-10-17-20(19-14)13-6-4-3-5-7-13;/h3-7,10-12H,8-9,16H2,1-2H3,(H,18,21);1H |
| InChIKey | AUQADGBFKSOOKJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |