C15H23Cl2N5O — CID 119587084
N-(1-amino-4-methylpentan-2-yl)-6-pyrazol-1-ylpyridine-2-carboxamide;dihydrochloride (PubChem CID 119587084) has the molecular formula C15H23Cl2N5O and a molecular weight of 360.29 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-6-pyrazol-1-ylpyridine-2-carboxamide;dihydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-6-pyrazol-1-ylpyridine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119587084 |
| Molecular Formula | C15H23Cl2N5O |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-6-pyrazol-1-ylpyridine-2-carboxamide;dihydrochloride |
| SMILES | CC(C)CC(CN)NC(=O)c1cccc(-n2cccn2)n1.Cl.Cl |
| InChI | InChI=1S/C15H21N5O.2ClH/c1-11(2)9-12(10-16)18-15(21)13-5-3-6-14(19-13)20-8-4-7-17-20;;/h3-8,11-12H,9-10,16H2,1-2H3,(H,18,21);2*1H |
| InChIKey | QKLYTZUGYPIIOB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |