C15H29N3O2S — CID 119588684
N-(1-amino-4-methylpentan-2-yl)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide (PubChem CID 119588684) has the molecular formula C15H29N3O2S and a molecular weight of 315.48 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide |
|---|---|
| PubChem CID | 119588684 |
| Molecular Formula | C15H29N3O2S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide |
| SMILES | CC(C)CC(CN)NC(=O)CSCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H29N3O2S/c1-12(2)8-13(9-16)17-14(19)10-21-11-15(20)18-6-4-3-5-7-18/h12-13H,3-11,16H2,1-2H3,(H,17,19) |
| InChIKey | YMUXDDNHINBFJN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |