C16H26ClN3O3 — CID 119589410
N-[3-[(2-amino-1-cyclohexylethyl)amino]-3-oxopropyl]furan-2-carboxamide;hydrochloride (PubChem CID 119589410) has the molecular formula C16H26ClN3O3 and a molecular weight of 343.86 g/mol. Its IUPAC name is N-[3-[(2-amino-1-cyclohexylethyl)amino]-3-oxopropyl]furan-2-carboxamide;hydrochloride.
| Compound Name | N-[3-[(2-amino-1-cyclohexylethyl)amino]-3-oxopropyl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119589410 |
| Molecular Formula | C16H26ClN3O3 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-[3-[(2-amino-1-cyclohexylethyl)amino]-3-oxopropyl]furan-2-carboxamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)CCNC(=O)c1ccco1)C1CCCCC1 |
| InChI | InChI=1S/C16H25N3O3.ClH/c17-11-13(12-5-2-1-3-6-12)19-15(20)8-9-18-16(21)14-7-4-10-22-14;/h4,7,10,12-13H,1-3,5-6,8-9,11,17H2,(H,18,21)(H,19,20);1H |
| InChIKey | PRQAUCXGPAVYIH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |