C14H28N4O2 — CID 119591011
(2R)-N-(2-amino-1-cyclohexylethyl)-2-(carbamoylamino)pentanamide (PubChem CID 119591011) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2R)-N-(2-amino-1-cyclohexylethyl)-2-(carbamoylamino)pentanamide.
| Compound Name | (2R)-N-(2-amino-1-cyclohexylethyl)-2-(carbamoylamino)pentanamide |
|---|---|
| PubChem CID | 119591011 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (2R)-N-(2-amino-1-cyclohexylethyl)-2-(carbamoylamino)pentanamide |
| SMILES | CCC[C@@H](NC(N)=O)C(=O)NC(CN)C1CCCCC1 |
| InChI | InChI=1S/C14H28N4O2/c1-2-6-11(18-14(16)20)13(19)17-12(9-15)10-7-4-3-5-8-10/h10-12H,2-9,15H2,1H3,(H,17,19)(H3,16,18,20)/t11-,12?/m1/s1 |
| InChIKey | YSRVJVKMIVHIAV-JHJMLUEUSA-N |
| XLogP | 0.85 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |