C19H28N4O3S — CID 119591544
N-(2-amino-1-cyclohexylethyl)-2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetamide (PubChem CID 119591544) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 119591544 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetamide |
| SMILES | CS(=O)(=O)Cc1nc2ccccc2n1CC(=O)NC(CN)C1CCCCC1 |
| InChI | InChI=1S/C19H28N4O3S/c1-27(25,26)13-18-21-15-9-5-6-10-17(15)23(18)12-19(24)22-16(11-20)14-7-3-2-4-8-14/h5-6,9-10,14,16H,2-4,7-8,11-13,20H2,1H3,(H,22,24) |
| InChIKey | VZZXSMTZTALDDE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |