C23H28ClN3O2 — CID 119590242
N-(2-amino-1-cyclohexylethyl)-2-(9-oxoacridin-10-yl)acetamide;hydrochloride (PubChem CID 119590242) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2-(9-oxoacridin-10-yl)acetamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2-(9-oxoacridin-10-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119590242 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2-(9-oxoacridin-10-yl)acetamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)Cn1c2ccccc2c(=O)c2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C23H27N3O2.ClH/c24-14-19(16-8-2-1-3-9-16)25-22(27)15-26-20-12-6-4-10-17(20)23(28)18-11-5-7-13-21(18)26;/h4-7,10-13,16,19H,1-3,8-9,14-15,24H2,(H,25,27);1H |
| InChIKey | QKBVHMWZMLNMIR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|