C22H22N2O5 — CID 120548015
2-(oxan-3-yl)-2-[[2-(9-oxoacridin-10-yl)acetyl]amino]acetic acid (PubChem CID 120548015) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-(oxan-3-yl)-2-[[2-(9-oxoacridin-10-yl)acetyl]amino]acetic acid.
| Compound Name | 2-(oxan-3-yl)-2-[[2-(9-oxoacridin-10-yl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 120548015 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-(oxan-3-yl)-2-[[2-(9-oxoacridin-10-yl)acetyl]amino]acetic acid |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)NC(C(=O)O)C1CCCOC1 |
| InChI | InChI=1S/C22H22N2O5/c25-19(23-20(22(27)28)14-6-5-11-29-13-14)12-24-17-9-3-1-7-15(17)21(26)16-8-2-4-10-18(16)24/h1-4,7-10,14,20H,5-6,11-13H2,(H,23,25)(H,27,28) |
| InChIKey | DBPOIQKJROWCIW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|