C16H29ClN4O — CID 119591594
N-(2-amino-1-cyclohexylethyl)-5-tert-butyl-1H-pyrazole-3-carboxamide;hydrochloride (PubChem CID 119591594) has the molecular formula C16H29ClN4O and a molecular weight of 328.89 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-5-tert-butyl-1H-pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-5-tert-butyl-1H-pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119591594 |
| Molecular Formula | C16H29ClN4O |
| Molecular Weight | 328.89 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-5-tert-butyl-1H-pyrazole-3-carboxamide;hydrochloride |
| SMILES | CC(C)(C)c1cc(C(=O)NC(CN)C2CCCCC2)n[nH]1.Cl |
| InChI | InChI=1S/C16H28N4O.ClH/c1-16(2,3)14-9-12(19-20-14)15(21)18-13(10-17)11-7-5-4-6-8-11;/h9,11,13H,4-8,10,17H2,1-3H3,(H,18,21)(H,19,20);1H |
| InChIKey | IHXFVVFTNWQIAB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.89 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |