C11H19ClN4O — CID 119617013
N-(2-amino-1-cyclopropylethyl)-5-ethyl-1H-pyrazole-3-carboxamide;hydrochloride (PubChem CID 119617013) has the molecular formula C11H19ClN4O and a molecular weight of 258.75 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-5-ethyl-1H-pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-5-ethyl-1H-pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119617013 |
| Molecular Formula | C11H19ClN4O |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-5-ethyl-1H-pyrazole-3-carboxamide;hydrochloride |
| SMILES | CCc1cc(C(=O)NC(CN)C2CC2)n[nH]1.Cl |
| InChI | InChI=1S/C11H18N4O.ClH/c1-2-8-5-9(15-14-8)11(16)13-10(6-12)7-3-4-7;/h5,7,10H,2-4,6,12H2,1H3,(H,13,16)(H,14,15);1H |
| InChIKey | WZQCXXLTVHSZBZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |