C11H16BrCl2N3O — CID 119614994
N-(2-amino-1-cyclopropylethyl)-5-bromopyridine-2-carboxamide;dihydrochloride (PubChem CID 119614994) has the molecular formula C11H16BrCl2N3O and a molecular weight of 357.08 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-5-bromopyridine-2-carboxamide;dihydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-5-bromopyridine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119614994 |
| Molecular Formula | C11H16BrCl2N3O |
| Molecular Weight | 357.08 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-5-bromopyridine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCC(NC(=O)c1ccc(Br)cn1)C1CC1 |
| InChI | InChI=1S/C11H14BrN3O.2ClH/c12-8-3-4-9(14-6-8)11(16)15-10(5-13)7-1-2-7;;/h3-4,6-7,10H,1-2,5,13H2,(H,15,16);2*1H |
| InChIKey | KVZQEXZFJCXRKQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.08 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |