C17H22Cl2N2O2 — CID 11959202
(2S,3R)-3-(3,4-dichlorophenyl)-N-(methoxymethyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 11959202) has the molecular formula C17H22Cl2N2O2 and a molecular weight of 357.28 g/mol. Its IUPAC name is (2S,3R)-3-(3,4-dichlorophenyl)-N-(methoxymethyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | (2S,3R)-3-(3,4-dichlorophenyl)-N-(methoxymethyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 11959202 |
| Molecular Formula | C17H22Cl2N2O2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (2S,3R)-3-(3,4-dichlorophenyl)-N-(methoxymethyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | COCNC(=O)[C@@H]1C2CCC(C[C@H]1c1ccc(Cl)c(Cl)c1)N2C |
| InChI | InChI=1S/C17H22Cl2N2O2/c1-21-11-4-6-15(21)16(17(22)20-9-23-2)12(8-11)10-3-5-13(18)14(19)7-10/h3,5,7,11-12,15-16H,4,6,8-9H2,1-2H3,(H,20,22)/t11?,12-,15?,16-/m0/s1 |
| InChIKey | NIEVRQBWELRCOH-ASNWCHJPSA-N |
| XLogP | 3.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|