C13H17BrCl2N2O — CID 119592450
(4-amino-3-methylpiperidin-1-yl)-(2-bromo-4-chlorophenyl)methanone;hydrochloride (PubChem CID 119592450) has the molecular formula C13H17BrCl2N2O and a molecular weight of 368.10 g/mol. Its IUPAC name is (4-amino-3-methylpiperidin-1-yl)-(2-bromo-4-chlorophenyl)methanone;hydrochloride.
| Compound Name | (4-amino-3-methylpiperidin-1-yl)-(2-bromo-4-chlorophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119592450 |
| Molecular Formula | C13H17BrCl2N2O |
| Molecular Weight | 368.10 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | (4-amino-3-methylpiperidin-1-yl)-(2-bromo-4-chlorophenyl)methanone;hydrochloride |
| SMILES | CC1CN(C(=O)c2ccc(Cl)cc2Br)CCC1N.Cl |
| InChI | InChI=1S/C13H16BrClN2O.ClH/c1-8-7-17(5-4-12(8)16)13(18)10-3-2-9(15)6-11(10)14;/h2-3,6,8,12H,4-5,7,16H2,1H3;1H |
| InChIKey | OXMKOPXBIVWUOA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.10 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |