C13H17Cl2IN2O — CID 119592350
(4-amino-3-methylpiperidin-1-yl)-(5-chloro-2-iodophenyl)methanone;hydrochloride (PubChem CID 119592350) has the molecular formula C13H17Cl2IN2O and a molecular weight of 415.10 g/mol. Its IUPAC name is (4-amino-3-methylpiperidin-1-yl)-(5-chloro-2-iodophenyl)methanone;hydrochloride.
| Compound Name | (4-amino-3-methylpiperidin-1-yl)-(5-chloro-2-iodophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119592350 |
| Molecular Formula | C13H17Cl2IN2O |
| Molecular Weight | 415.10 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | (4-amino-3-methylpiperidin-1-yl)-(5-chloro-2-iodophenyl)methanone;hydrochloride |
| SMILES | CC1CN(C(=O)c2cc(Cl)ccc2I)CCC1N.Cl |
| InChI | InChI=1S/C13H16ClIN2O.ClH/c1-8-7-17(5-4-12(8)16)13(18)10-6-9(14)2-3-11(10)15;/h2-3,6,8,12H,4-5,7,16H2,1H3;1H |
| InChIKey | RJVMPGGUEDVZED-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.10 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|