C11H12ClIN2O — CID 103805035
[(3R)-3-aminopyrrolidin-1-yl]-(5-chloro-2-iodophenyl)methanone (PubChem CID 103805035) has the molecular formula C11H12ClIN2O and a molecular weight of 350.59 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-(5-chloro-2-iodophenyl)methanone.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-(5-chloro-2-iodophenyl)methanone |
|---|---|
| PubChem CID | 103805035 |
| Molecular Formula | C11H12ClIN2O |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-(5-chloro-2-iodophenyl)methanone |
| SMILES | N[C@@H]1CCN(C(=O)c2cc(Cl)ccc2I)C1 |
| InChI | InChI=1S/C11H12ClIN2O/c12-7-1-2-10(13)9(5-7)11(16)15-4-3-8(14)6-15/h1-2,5,8H,3-4,6,14H2/t8-/m1/s1 |
| InChIKey | LZBRGKWGJRJJNT-MRVPVSSYSA-N |
| XLogP | 2.12 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|