C17H25BrN2O2 — CID 119593508
[3-(1-aminoethyl)piperidin-1-yl]-(4-bromo-2-propan-2-yloxyphenyl)methanone (PubChem CID 119593508) has the molecular formula C17H25BrN2O2 and a molecular weight of 369.30 g/mol. Its IUPAC name is [3-(1-aminoethyl)piperidin-1-yl]-(4-bromo-2-propan-2-yloxyphenyl)methanone.
| Compound Name | [3-(1-aminoethyl)piperidin-1-yl]-(4-bromo-2-propan-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 119593508 |
| Molecular Formula | C17H25BrN2O2 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | [3-(1-aminoethyl)piperidin-1-yl]-(4-bromo-2-propan-2-yloxyphenyl)methanone |
| SMILES | CC(C)Oc1cc(Br)ccc1C(=O)N1CCCC(C(C)N)C1 |
| InChI | InChI=1S/C17H25BrN2O2/c1-11(2)22-16-9-14(18)6-7-15(16)17(21)20-8-4-5-13(10-20)12(3)19/h6-7,9,11-13H,4-5,8,10,19H2,1-3H3 |
| InChIKey | VAPPHJCAAATOSV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |