C15H20F2N2O — CID 119594480
1-[3-(1-aminoethyl)piperidin-1-yl]-2,2-difluoro-2-phenylethanone (PubChem CID 119594480) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is 1-[3-(1-aminoethyl)piperidin-1-yl]-2,2-difluoro-2-phenylethanone.
| Compound Name | 1-[3-(1-aminoethyl)piperidin-1-yl]-2,2-difluoro-2-phenylethanone |
|---|---|
| PubChem CID | 119594480 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-[3-(1-aminoethyl)piperidin-1-yl]-2,2-difluoro-2-phenylethanone |
| SMILES | CC(N)C1CCCN(C(=O)C(F)(F)c2ccccc2)C1 |
| InChI | InChI=1S/C15H20F2N2O/c1-11(18)12-6-5-9-19(10-12)14(20)15(16,17)13-7-3-2-4-8-13/h2-4,7-8,11-12H,5-6,9-10,18H2,1H3 |
| InChIKey | KXEFSHGHBALLKI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |