C18H25ClN4O3 — CID 119597029
5-[4-[2-(aminomethyl)-3-methylpiperidine-1-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione;hydrochloride (PubChem CID 119597029) has the molecular formula C18H25ClN4O3 and a molecular weight of 380.88 g/mol. Its IUPAC name is 5-[4-[2-(aminomethyl)-3-methylpiperidine-1-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione;hydrochloride.
| Compound Name | 5-[4-[2-(aminomethyl)-3-methylpiperidine-1-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 119597029 |
| Molecular Formula | C18H25ClN4O3 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 5-[4-[2-(aminomethyl)-3-methylpiperidine-1-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione;hydrochloride |
| SMILES | CC1CCCN(C(=O)c2ccc(C3(C)NC(=O)NC3=O)cc2)C1CN.Cl |
| InChI | InChI=1S/C18H24N4O3.ClH/c1-11-4-3-9-22(14(11)10-19)15(23)12-5-7-13(8-6-12)18(2)16(24)20-17(25)21-18;/h5-8,11,14H,3-4,9-10,19H2,1-2H3,(H2,20,21,24,25);1H |
| InChIKey | AUSCTCJUAXXSMA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|