C16H22ClN5O — CID 119597279
[2-(aminomethyl)-3-methylpiperidin-1-yl]-(2-phenyltriazol-4-yl)methanone;hydrochloride (PubChem CID 119597279) has the molecular formula C16H22ClN5O and a molecular weight of 335.84 g/mol. Its IUPAC name is [2-(aminomethyl)-3-methylpiperidin-1-yl]-(2-phenyltriazol-4-yl)methanone;hydrochloride.
| Compound Name | [2-(aminomethyl)-3-methylpiperidin-1-yl]-(2-phenyltriazol-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119597279 |
| Molecular Formula | C16H22ClN5O |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | [2-(aminomethyl)-3-methylpiperidin-1-yl]-(2-phenyltriazol-4-yl)methanone;hydrochloride |
| SMILES | CC1CCCN(C(=O)c2cnn(-c3ccccc3)n2)C1CN.Cl |
| InChI | InChI=1S/C16H21N5O.ClH/c1-12-6-5-9-20(15(12)10-17)16(22)14-11-18-21(19-14)13-7-3-2-4-8-13;/h2-4,7-8,11-12,15H,5-6,9-10,17H2,1H3;1H |
| InChIKey | VEYCGCJYNOMTNR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |