C13H16ClN5O — CID 119412778
[(3R)-3-aminopyrrolidin-1-yl]-(2-phenyltriazol-4-yl)methanone;hydrochloride (PubChem CID 119412778) has the molecular formula C13H16ClN5O and a molecular weight of 293.76 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-(2-phenyltriazol-4-yl)methanone;hydrochloride.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-(2-phenyltriazol-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119412778 |
| Molecular Formula | C13H16ClN5O |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-(2-phenyltriazol-4-yl)methanone;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(C(=O)c2cnn(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C13H15N5O.ClH/c14-10-6-7-17(9-10)13(19)12-8-15-18(16-12)11-4-2-1-3-5-11;/h1-5,8,10H,6-7,9,14H2;1H/t10-;/m1./s1 |
| InChIKey | GXNJXTOLEZMQAX-HNCPQSOCSA-N |
| XLogP | 0.86 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |