C15H18ClN5O — CID 120660181
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-phenyltriazol-4-yl)methanone;hydrochloride (PubChem CID 120660181) has the molecular formula C15H18ClN5O and a molecular weight of 319.80 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-phenyltriazol-4-yl)methanone;hydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-phenyltriazol-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120660181 |
| Molecular Formula | C15H18ClN5O |
| Molecular Weight | 319.80 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-phenyltriazol-4-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1cnn(-c2ccccc2)n1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C15H17N5O.ClH/c21-15(19-9-11-6-16-7-12(11)10-19)14-8-17-20(18-14)13-4-2-1-3-5-13;/h1-5,8,11-12,16H,6-7,9-10H2;1H/t11-,12+; |
| InChIKey | AIOFNVQSXPZWGY-IWKKHLOMSA-N |
| XLogP | 0.98 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.80 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |