C14H17N5O — CID 28774472
1,4-diazepan-1-yl-(2-phenyltriazol-4-yl)methanone (PubChem CID 28774472) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-(2-phenyltriazol-4-yl)methanone.
| Compound Name | 1,4-diazepan-1-yl-(2-phenyltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 28774472 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1,4-diazepan-1-yl-(2-phenyltriazol-4-yl)methanone |
| SMILES | O=C(c1cnn(-c2ccccc2)n1)N1CCCNCC1 |
| InChI | InChI=1S/C14H17N5O/c20-14(18-9-4-7-15-8-10-18)13-11-16-19(17-13)12-5-2-1-3-6-12/h1-3,5-6,11,15H,4,7-10H2 |
| InChIKey | DFQOIPAUKZSFDS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |