C12H12N4O2 — CID 55178970
(3-hydroxyazetidin-1-yl)-(2-phenyltriazol-4-yl)methanone (PubChem CID 55178970) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is (3-hydroxyazetidin-1-yl)-(2-phenyltriazol-4-yl)methanone.
| Compound Name | (3-hydroxyazetidin-1-yl)-(2-phenyltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 55178970 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (3-hydroxyazetidin-1-yl)-(2-phenyltriazol-4-yl)methanone |
| SMILES | O=C(c1cnn(-c2ccccc2)n1)N1CC(O)C1 |
| InChI | InChI=1S/C12H12N4O2/c17-10-7-15(8-10)12(18)11-6-13-16(14-11)9-4-2-1-3-5-9/h1-6,10,17H,7-8H2 |
| InChIKey | SIRQJTMNTSJIOL-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |