C17H29N3O3S — CID 119598442
N-(1-amino-2,4-dimethylpentan-2-yl)-4-(propylsulfonylamino)benzamide (PubChem CID 119598442) has the molecular formula C17H29N3O3S and a molecular weight of 355.50 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-4-(propylsulfonylamino)benzamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-4-(propylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 119598442 |
| Molecular Formula | C17H29N3O3S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-4-(propylsulfonylamino)benzamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(C(=O)NC(C)(CN)CC(C)C)cc1 |
| InChI | InChI=1S/C17H29N3O3S/c1-5-10-24(22,23)20-15-8-6-14(7-9-15)16(21)19-17(4,12-18)11-13(2)3/h6-9,13,20H,5,10-12,18H2,1-4H3,(H,19,21) |
| InChIKey | WFQXPVZRORJPMF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |