C15H24N2O3S — CID 81486139
N-(1-amino-2,4-dimethylpentan-2-yl)-4-methylsulfonylbenzamide (PubChem CID 81486139) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-4-methylsulfonylbenzamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 81486139 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-4-methylsulfonylbenzamide |
| SMILES | CC(C)CC(C)(CN)NC(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H24N2O3S/c1-11(2)9-15(3,10-16)17-14(18)12-5-7-13(8-6-12)21(4,19)20/h5-8,11H,9-10,16H2,1-4H3,(H,17,18) |
| InChIKey | ZRNFMFQXEWFNFZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |