About N-(1-amino-2,4-dimethylpentan-2-yl)-2-(4-fluorophenyl)triazole-4-carboxamide
N-(1-amino-2,4-dimethylpentan-2-yl)-2-(4-fluorophenyl)triazole-4-carboxamide (PubChem CID 119598860) has the molecular formula C16H22FN5O
and a molecular weight of 319.38 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-2-(4-fluorophenyl)triazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2-(4-fluorophenyl)triazole-4-carboxamide |
| PubChem CID | 119598860 |
| Molecular Formula | C16H22FN5O |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2-(4-fluorophenyl)triazole-4-carboxamide |
| SMILES | CC(C)CC(C)(CN)NC(=O)c1cnn(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C16H22FN5O/c1-11(2)8-16(3,10-18)20-15(23)14-9-19-22(21-14)13-6-4-12(17)5-7-13/h4-7,9,11H,8,10,18H2,1-3H3,(H,20,23) |
| InChIKey | QTUVKLYXPHAKMP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-amino-2,4-dimethylpentan-2-yl)-2-(4-fluorophenyl)triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-2,4-dimethylpentan-2-yl)-2-(4-fluorophenyl)triazole-4-carboxamide?
The IUPAC name of N-(1-amino-2,4-dimethylpentan-2-yl)-2-(4-fluorophenyl)triazole-4-carboxamide (CID 119598860) is N-(1-amino-2,4-dimethylpentan-2-yl)-2-(4-fluorophenyl)triazole-4-carboxamide.
What is the SMILES notation for N-(1-amino-2,4-dimethylpentan-2-yl)-2-(4-fluorophenyl)triazole-4-carboxamide?
The canonical SMILES for N-(1-amino-2,4-dimethylpentan-2-yl)-2-(4-fluorophenyl)triazole-4-carboxamide is CC(C)CC(C)(CN)NC(=O)c1cnn(-c2ccc(F)cc2)n1.
What is the InChIKey of N-(1-amino-2,4-dimethylpentan-2-yl)-2-(4-fluorophenyl)triazole-4-carboxamide?
The InChIKey is QTUVKLYXPHAKMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22FN5O/c1-11(2)8-16(3,10-18)20-15(23)14-9-19-22(21-14)13-6-4-12(17)5-7-13/h4-7,9,11H,8,10,18H2,1-3H3,(H,20,23).
What are the key properties of N-(1-amino-2,4-dimethylpentan-2-yl)-2-(4-fluorophenyl)triazole-4-carboxamide?
N-(1-amino-2,4-dimethylpentan-2-yl)-2-(4-fluorophenyl)triazole-4-carboxamide has a molecular weight of 319.38 g/mol, XLogP of 1.90, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-2,4-dimethylpentan-2-yl)-2-(4-fluorophenyl)triazole-4-carboxamide is sourced from PubChem (CID 119598860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).