C10H9FN4O3S — CID 146154734
2-(4-fluorophenyl)-N-methylsulfonyltriazole-4-carboxamide (PubChem CID 146154734) has the molecular formula C10H9FN4O3S and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-methylsulfonyltriazole-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-methylsulfonyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 146154734 |
| Molecular Formula | C10H9FN4O3S |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-(4-fluorophenyl)-N-methylsulfonyltriazole-4-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)c1cnn(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C10H9FN4O3S/c1-19(17,18)14-10(16)9-6-12-15(13-9)8-4-2-7(11)3-5-8/h2-6H,1H3,(H,14,16) |
| InChIKey | IPPYVFDVZDIZCB-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |