C15H19ClFN5O — CID 120576916
2-(4-fluorophenyl)-N-(2-methylpiperidin-3-yl)triazole-4-carboxamide;hydrochloride (PubChem CID 120576916) has the molecular formula C15H19ClFN5O and a molecular weight of 339.80 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(2-methylpiperidin-3-yl)triazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(4-fluorophenyl)-N-(2-methylpiperidin-3-yl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120576916 |
| Molecular Formula | C15H19ClFN5O |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(2-methylpiperidin-3-yl)triazole-4-carboxamide;hydrochloride |
| SMILES | CC1NCCCC1NC(=O)c1cnn(-c2ccc(F)cc2)n1.Cl |
| InChI | InChI=1S/C15H18FN5O.ClH/c1-10-13(3-2-8-17-10)19-15(22)14-9-18-21(20-14)12-6-4-11(16)5-7-12;/h4-7,9-10,13,17H,2-3,8H2,1H3,(H,19,22);1H |
| InChIKey | WNQKDRYIQBDUPX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |