C14H17ClFN5O — CID 119512213
2-(4-fluorophenyl)-N-(pyrrolidin-2-ylmethyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119512213) has the molecular formula C14H17ClFN5O and a molecular weight of 325.78 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(pyrrolidin-2-ylmethyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(4-fluorophenyl)-N-(pyrrolidin-2-ylmethyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119512213 |
| Molecular Formula | C14H17ClFN5O |
| Molecular Weight | 325.78 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(pyrrolidin-2-ylmethyl)triazole-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC1CCCN1)c1cnn(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H16FN5O.ClH/c15-10-3-5-12(6-4-10)20-18-9-13(19-20)14(21)17-8-11-2-1-7-16-11;/h3-6,9,11,16H,1-2,7-8H2,(H,17,21);1H |
| InChIKey | XLNQGLZZTMSTAE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.78 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |