C16H19FN4O2 — CID 111485653
2-(4-fluorophenyl)-N-[(1-hydroxycyclohexyl)methyl]triazole-4-carboxamide (PubChem CID 111485653) has the molecular formula C16H19FN4O2 and a molecular weight of 318.35 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[(1-hydroxycyclohexyl)methyl]triazole-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[(1-hydroxycyclohexyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 111485653 |
| Molecular Formula | C16H19FN4O2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[(1-hydroxycyclohexyl)methyl]triazole-4-carboxamide |
| SMILES | O=C(NCC1(O)CCCCC1)c1cnn(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C16H19FN4O2/c17-12-4-6-13(7-5-12)21-19-10-14(20-21)15(22)18-11-16(23)8-2-1-3-9-16/h4-7,10,23H,1-3,8-9,11H2,(H,18,22) |
| InChIKey | ZDIUAPUEOCPKGL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |