C17H16F2N6O3 — CID 166636596
N-[(4-cyclobutyl-2,5-dioxoimidazolidin-4-yl)methyl]-2-(3,4-difluorophenyl)triazole-4-carboxamide (PubChem CID 166636596) has the molecular formula C17H16F2N6O3 and a molecular weight of 390.35 g/mol. Its IUPAC name is N-[(4-cyclobutyl-2,5-dioxoimidazolidin-4-yl)methyl]-2-(3,4-difluorophenyl)triazole-4-carboxamide.
| Compound Name | N-[(4-cyclobutyl-2,5-dioxoimidazolidin-4-yl)methyl]-2-(3,4-difluorophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 166636596 |
| Molecular Formula | C17H16F2N6O3 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-[(4-cyclobutyl-2,5-dioxoimidazolidin-4-yl)methyl]-2-(3,4-difluorophenyl)triazole-4-carboxamide |
| SMILES | O=C1NC(=O)C(CNC(=O)c2cnn(-c3ccc(F)c(F)c3)n2)(C2CCC2)N1 |
| InChI | InChI=1S/C17H16F2N6O3/c18-11-5-4-10(6-12(11)19)25-21-7-13(24-25)14(26)20-8-17(9-2-1-3-9)15(27)22-16(28)23-17/h4-7,9H,1-3,8H2,(H,20,26)(H2,22,23,27,28) |
| InChIKey | PCJYSYOTNARBTD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|