C14H13FN6O3 — CID 175783171
2-(4-fluorophenyl)-N-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methyl]triazole-4-carboxamide (PubChem CID 175783171) has the molecular formula C14H13FN6O3 and a molecular weight of 332.30 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methyl]triazole-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 175783171 |
| Molecular Formula | C14H13FN6O3 |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methyl]triazole-4-carboxamide |
| SMILES | C[C@]1(CNC(=O)c2cnn(-c3ccc(F)cc3)n2)NC(=O)NC1=O |
| InChI | InChI=1S/C14H13FN6O3/c1-14(12(23)18-13(24)19-14)7-16-11(22)10-6-17-21(20-10)9-4-2-8(15)3-5-9/h2-6H,7H2,1H3,(H,16,22)(H2,18,19,23,24)/t14-/m1/s1 |
| InChIKey | LHFGQYRURUPDIG-CQSZACIVSA-N |
| XLogP | -0.27 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|