C18H20N6O4 — CID 175783320
N-[[(4R)-4-(oxan-4-yl)-2,5-dioxoimidazolidin-4-yl]methyl]-2-phenyltriazole-4-carboxamide (PubChem CID 175783320) has the molecular formula C18H20N6O4 and a molecular weight of 384.40 g/mol. Its IUPAC name is N-[[(4R)-4-(oxan-4-yl)-2,5-dioxoimidazolidin-4-yl]methyl]-2-phenyltriazole-4-carboxamide.
| Compound Name | N-[[(4R)-4-(oxan-4-yl)-2,5-dioxoimidazolidin-4-yl]methyl]-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 175783320 |
| Molecular Formula | C18H20N6O4 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[[(4R)-4-(oxan-4-yl)-2,5-dioxoimidazolidin-4-yl]methyl]-2-phenyltriazole-4-carboxamide |
| SMILES | O=C1NC(=O)[C@](CNC(=O)c2cnn(-c3ccccc3)n2)(C2CCOCC2)N1 |
| InChI | InChI=1S/C18H20N6O4/c25-15(14-10-20-24(23-14)13-4-2-1-3-5-13)19-11-18(12-6-8-28-9-7-12)16(26)21-17(27)22-18/h1-5,10,12H,6-9,11H2,(H,19,25)(H2,21,22,26,27)/t18-/m0/s1 |
| InChIKey | AINYNRPFOAVLRC-SFHVURJKSA-N |
| XLogP | 0.00 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|