C15H20Cl2N4O — CID 119600664
N-[2-(aminomethyl)cyclopentyl]quinoxaline-2-carboxamide;dihydrochloride (PubChem CID 119600664) has the molecular formula C15H20Cl2N4O and a molecular weight of 343.26 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]quinoxaline-2-carboxamide;dihydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]quinoxaline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119600664 |
| Molecular Formula | C15H20Cl2N4O |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]quinoxaline-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCC1CCCC1NC(=O)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C15H18N4O.2ClH/c16-8-10-4-3-7-11(10)19-15(20)14-9-17-12-5-1-2-6-13(12)18-14;;/h1-2,5-6,9-11H,3-4,7-8,16H2,(H,19,20);2*1H |
| InChIKey | FQPPWUHFQTXGHM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |