C12H20Cl2N4O — CID 119611743
N-[2-(aminomethyl)cyclohexyl]pyrazine-2-carboxamide;dihydrochloride (PubChem CID 119611743) has the molecular formula C12H20Cl2N4O and a molecular weight of 307.23 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]pyrazine-2-carboxamide;dihydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]pyrazine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119611743 |
| Molecular Formula | C12H20Cl2N4O |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]pyrazine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCC1CCCCC1NC(=O)c1cnccn1 |
| InChI | InChI=1S/C12H18N4O.2ClH/c13-7-9-3-1-2-4-10(9)16-12(17)11-8-14-5-6-15-11;;/h5-6,8-10H,1-4,7,13H2,(H,16,17);2*1H |
| InChIKey | WCKYASBUXYYPCT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |